C24H30N3O7S- — CID 19928572
5-[[3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylate (PubChem CID 19928572) has the molecular formula C24H30N3O7S- and a molecular weight of 504.59 g/mol. Its IUPAC name is 5-[[3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylate.
| Compound Name | 5-[[3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928572 |
| Molecular Formula | C24H30N3O7S- |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 5-[[3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylate |
| SMILES | CCCCCc1cc(C(=O)NS(=O)(=O)c2cccc(C(=O)NCCCOCC)c2)cnc1C(=O)[O-] |
| InChI | InChI=1S/C24H31N3O7S/c1-3-5-6-9-17-14-19(16-26-21(17)24(30)31)23(29)27-35(32,33)20-11-7-10-18(15-20)22(28)25-12-8-13-34-4-2/h7,10-11,14-16H,3-6,8-9,12-13H2,1-2H3,(H,25,28)(H,27,29)(H,30,31)/p-1 |
| InChIKey | NCRHRPQFUZJNGG-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 154.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|