C29H32N3O6S- — CID 19928639
3-pentyl-5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928639) has the molecular formula C29H32N3O6S- and a molecular weight of 550.66 g/mol. Its IUPAC name is 3-pentyl-5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | 3-pentyl-5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928639 |
| Molecular Formula | C29H32N3O6S- |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 3-pentyl-5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCCCc1cc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCCCc3ccccc3)cc2)cnc1C(=O)[O-] |
| InChI | InChI=1S/C29H33N3O6S/c1-2-3-5-13-23-19-24(20-31-26(23)29(35)36)28(34)32-39(37,38)25-16-14-22(15-17-25)27(33)30-18-9-8-12-21-10-6-4-7-11-21/h4,6-7,10-11,14-17,19-20H,2-3,5,8-9,12-13,18H2,1H3,(H,30,33)(H,32,34)(H,35,36)/p-1 |
| InChIKey | YYUZPQBXSCDAKF-UHFFFAOYSA-M |
| XLogP | 3.05 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|