C30H34N3O7S- — CID 19928404
4-heptyl-5-[[4-[2-(4-methoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928404) has the molecular formula C30H34N3O7S- and a molecular weight of 580.68 g/mol. Its IUPAC name is 4-heptyl-5-[[4-[2-(4-methoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | 4-heptyl-5-[[4-[2-(4-methoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928404 |
| Molecular Formula | C30H34N3O7S- |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 4-heptyl-5-[[4-[2-(4-methoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCCCCCc1cc(C(=O)[O-])ncc1C(=O)NS(=O)(=O)c1ccc(C(=O)NCCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O7S/c1-3-4-5-6-7-8-23-19-27(30(36)37)32-20-26(23)29(35)33-41(38,39)25-15-11-22(12-16-25)28(34)31-18-17-21-9-13-24(40-2)14-10-21/h9-16,19-20H,3-8,17-18H2,1-2H3,(H,31,34)(H,33,35)(H,36,37)/p-1 |
| InChIKey | GZHQFPPJESVSSK-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 154.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|