C27H34N3O6S- — CID 19928314
5-[[4-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-4-heptylpyridine-2-carboxylate (PubChem CID 19928314) has the molecular formula C27H34N3O6S- and a molecular weight of 528.65 g/mol. Its IUPAC name is 5-[[4-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-4-heptylpyridine-2-carboxylate.
| Compound Name | 5-[[4-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-4-heptylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928314 |
| Molecular Formula | C27H34N3O6S- |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 5-[[4-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-4-heptylpyridine-2-carboxylate |
| SMILES | CCCCCCCc1cc(C(=O)[O-])ncc1C(=O)NS(=O)(=O)c1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H35N3O6S/c1-2-3-4-5-7-10-20-17-24(27(33)34)28-18-23(20)26(32)30-37(35,36)22-15-13-19(14-16-22)25(31)29-21-11-8-6-9-12-21/h13-18,21H,2-12H2,1H3,(H,29,31)(H,30,32)(H,33,34)/p-1 |
| InChIKey | PHMWLKZOKVAWRG-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|