C26H27N3O6S — CID 19928347
5-[[3-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid (PubChem CID 19928347) has the molecular formula C26H27N3O6S and a molecular weight of 509.58 g/mol. Its IUPAC name is 5-[[3-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid.
| Compound Name | 5-[[3-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19928347 |
| Molecular Formula | C26H27N3O6S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 5-[[3-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
| SMILES | CCCCCc1cc(C(=O)NS(=O)(=O)c2cccc(C(=O)NCc3ccccc3)c2)cnc1C(=O)O |
| InChI | InChI=1S/C26H27N3O6S/c1-2-3-5-11-19-14-21(17-27-23(19)26(32)33)25(31)29-36(34,35)22-13-8-12-20(15-22)24(30)28-16-18-9-6-4-7-10-18/h4,6-10,12-15,17H,2-3,5,11,16H2,1H3,(H,28,30)(H,29,31)(H,32,33) |
| InChIKey | UVIGBLFQYHPFFK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|