C19H25N3O3S — CID 109064162
N-benzyl-3-[3-(dimethylamino)propylsulfamoyl]benzamide (PubChem CID 109064162) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-benzyl-3-[3-(dimethylamino)propylsulfamoyl]benzamide.
| Compound Name | N-benzyl-3-[3-(dimethylamino)propylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 109064162 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-benzyl-3-[3-(dimethylamino)propylsulfamoyl]benzamide |
| SMILES | CN(C)CCCNS(=O)(=O)c1cccc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-22(2)13-7-12-21-26(24,25)18-11-6-10-17(14-18)19(23)20-15-16-8-4-3-5-9-16/h3-6,8-11,14,21H,7,12-13,15H2,1-2H3,(H,20,23) |
| InChIKey | LRBRQCACHFBABX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|