C24H31N3O6S — CID 19928620
5-[[4-(2-methylpentanoylamino)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid (PubChem CID 19928620) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is 5-[[4-(2-methylpentanoylamino)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid.
| Compound Name | 5-[[4-(2-methylpentanoylamino)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19928620 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 5-[[4-(2-methylpentanoylamino)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
| SMILES | CCCCCc1cc(C(=O)NS(=O)(=O)c2ccc(NC(=O)C(C)CCC)cc2)cnc1C(=O)O |
| InChI | InChI=1S/C24H31N3O6S/c1-4-6-7-9-17-14-18(15-25-21(17)24(30)31)23(29)27-34(32,33)20-12-10-19(11-13-20)26-22(28)16(3)8-5-2/h10-16H,4-9H2,1-3H3,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | YWTUGUHVANRGTF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|