C30H35N5O2 — CID 56650667
5-(4-benzylpiperazine-1-carbonyl)-N-(1-benzylpiperidin-4-yl)pyridine-2-carboxamide (PubChem CID 56650667) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 5-(4-benzylpiperazine-1-carbonyl)-N-(1-benzylpiperidin-4-yl)pyridine-2-carboxamide.
| Compound Name | 5-(4-benzylpiperazine-1-carbonyl)-N-(1-benzylpiperidin-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56650667 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 5-(4-benzylpiperazine-1-carbonyl)-N-(1-benzylpiperidin-4-yl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1ccc(C(=O)N2CCN(Cc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C30H35N5O2/c36-29(32-27-13-15-33(16-14-27)22-24-7-3-1-4-8-24)28-12-11-26(21-31-28)30(37)35-19-17-34(18-20-35)23-25-9-5-2-6-10-25/h1-12,21,27H,13-20,22-23H2,(H,32,36) |
| InChIKey | OQMKCTWXRSKXFX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |