C33H30N4O2 — CID 122486199
5-(4-benzylbenzoyl)-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]pyridine-2-carboxamide (PubChem CID 122486199) has the molecular formula C33H30N4O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 5-(4-benzylbenzoyl)-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]pyridine-2-carboxamide.
| Compound Name | 5-(4-benzylbenzoyl)-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122486199 |
| Molecular Formula | C33H30N4O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 5-(4-benzylbenzoyl)-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(CN2CCC(NC(=O)c3ccc(C(=O)c4ccc(Cc5ccccc5)cc4)cn3)CC2)cc1 |
| InChI | InChI=1S/C33H30N4O2/c34-21-26-6-8-27(9-7-26)23-37-18-16-30(17-19-37)36-33(39)31-15-14-29(22-35-31)32(38)28-12-10-25(11-13-28)20-24-4-2-1-3-5-24/h1-15,22,30H,16-20,23H2,(H,36,39) |
| InChIKey | JVHKOFNXLVBDAK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |