C31H30N4O2 — CID 66710236
2-N-(1-benzylpiperidin-4-yl)-5-N-(3-phenylphenyl)pyridine-2,5-dicarboxamide (PubChem CID 66710236) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-5-N-(3-phenylphenyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-5-N-(3-phenylphenyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 66710236 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-5-N-(3-phenylphenyl)pyridine-2,5-dicarboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)c1ccc(C(=O)NC2CCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C31H30N4O2/c36-30(34-28-13-7-12-25(20-28)24-10-5-2-6-11-24)26-14-15-29(32-21-26)31(37)33-27-16-18-35(19-17-27)22-23-8-3-1-4-9-23/h1-15,20-21,27H,16-19,22H2,(H,33,37)(H,34,36) |
| InChIKey | RUQCHWUZRNYFAS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |