C31H36N4O2 — CID 58073212
1-[5-(4-benzylpiperazine-1-carbonyl)-2-pyridinyl]-2-(1-benzylpiperidin-4-yl)ethanone (PubChem CID 58073212) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 1-[5-(4-benzylpiperazine-1-carbonyl)-2-pyridinyl]-2-(1-benzylpiperidin-4-yl)ethanone.
| Compound Name | 1-[5-(4-benzylpiperazine-1-carbonyl)-2-pyridinyl]-2-(1-benzylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 58073212 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 1-[5-(4-benzylpiperazine-1-carbonyl)-2-pyridinyl]-2-(1-benzylpiperidin-4-yl)ethanone |
| SMILES | O=C(CC1CCN(Cc2ccccc2)CC1)c1ccc(C(=O)N2CCN(Cc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C31H36N4O2/c36-30(21-25-13-15-33(16-14-25)23-26-7-3-1-4-8-26)29-12-11-28(22-32-29)31(37)35-19-17-34(18-20-35)24-27-9-5-2-6-10-27/h1-12,22,25H,13-21,23-24H2 |
| InChIKey | UONDHFJYFSPLQD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |