C18H18F3N3O — CID 30773012
(4-benzylpiperazin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 30773012) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 30773012 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H18F3N3O/c19-18(20,21)16-7-6-15(12-22-16)17(25)24-10-8-23(9-11-24)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | AGEPPZKFCHRBHM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |