C26H26ClN5OS — CID 126042515
N-[(E)-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126042515) has the molecular formula C26H26ClN5OS and a molecular weight of 492.05 g/mol. Its IUPAC name is N-[(E)-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(E)-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126042515 |
| Molecular Formula | C26H26ClN5OS |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[(E)-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1ccc2c(c1)c(/C=N/NC(=O)CSc1nc(C)cc(C)n1)c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26ClN5OS/c1-16-5-10-24-22(11-16)23(19(4)32(24)14-20-6-8-21(27)9-7-20)13-28-31-25(33)15-34-26-29-17(2)12-18(3)30-26/h5-13H,14-15H2,1-4H3,(H,31,33)/b28-13+ |
| InChIKey | KJXJUYBXSJVLAA-XODNFHPESA-N |
| XLogP | 5.61 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|