C22H25N5OS — CID 126044772
N-[(E)-(2,5-dimethyl-1-prop-2-enylindol-3-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126044772) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethyl-1-prop-2-enylindol-3-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(2,5-dimethyl-1-prop-2-enylindol-3-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126044772 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(E)-(2,5-dimethyl-1-prop-2-enylindol-3-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(C)c(/C=N/NC(=O)CSc2nc(C)cc(C)n2)c2cc(C)ccc21 |
| InChI | InChI=1S/C22H25N5OS/c1-6-9-27-17(5)19(18-10-14(2)7-8-20(18)27)12-23-26-21(28)13-29-22-24-15(3)11-16(4)25-22/h6-8,10-12H,1,9,13H2,2-5H3,(H,26,28)/b23-12+ |
| InChIKey | OJUDHQPELDZRRN-FSJBWODESA-N |
| XLogP | 4.09 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|