C25H23Cl2N5OS — CID 126257168
N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126257168) has the molecular formula C25H23Cl2N5OS and a molecular weight of 512.47 g/mol. Its IUPAC name is N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126257168 |
| Molecular Formula | C25H23Cl2N5OS |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N/N=C\c2c(C)n(Cc3ccc(Cl)cc3Cl)c3ccccc23)n1 |
| InChI | InChI=1S/C25H23Cl2N5OS/c1-15-10-16(2)30-25(29-15)34-14-24(33)31-28-12-21-17(3)32(23-7-5-4-6-20(21)23)13-18-8-9-19(26)11-22(18)27/h4-12H,13-14H2,1-3H3,(H,31,33)/b28-12- |
| InChIKey | SKQNWNYTBBUKSQ-NVJOKUIPSA-N |
| XLogP | 5.95 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|