C26H27ClN4O3S — CID 126240724
N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126240724) has the molecular formula C26H27ClN4O3S and a molecular weight of 511.05 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126240724 |
| Molecular Formula | C26H27ClN4O3S |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc(OC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN4O3S/c1-5-6-21-12-20(13-23(33-4)25(21)34-15-19-7-9-22(27)10-8-19)14-28-31-24(32)16-35-26-29-17(2)11-18(3)30-26/h5,7-14H,1,6,15-16H2,2-4H3,(H,31,32)/b28-14- |
| InChIKey | NNJINWUFEKENEA-MUXKCCDJSA-N |
| XLogP | 5.31 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|