C20H21BrN4S — CID 4260907
1-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-ethylthiourea (PubChem CID 4260907) has the molecular formula C20H21BrN4S and a molecular weight of 429.39 g/mol. Its IUPAC name is 1-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 4260907 |
| Molecular Formula | C20H21BrN4S |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=Cc1c(C)n(Cc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C20H21BrN4S/c1-3-22-20(26)24-23-12-18-14(2)25(19-7-5-4-6-17(18)19)13-15-8-10-16(21)11-9-15/h4-12H,3,13H2,1-2H3,(H2,22,24,26) |
| InChIKey | GQTWYYCRABFWPT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|