C17H13F7N2S — CID 126047665
1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-prop-2-enylsulfanylnaphthalen-1-yl)methylideneamino]propan-1-amine (PubChem CID 126047665) has the molecular formula C17H13F7N2S and a molecular weight of 410.36 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-prop-2-enylsulfanylnaphthalen-1-yl)methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-prop-2-enylsulfanylnaphthalen-1-yl)methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126047665 |
| Molecular Formula | C17H13F7N2S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-prop-2-enylsulfanylnaphthalen-1-yl)methylideneamino]propan-1-amine |
| SMILES | C=CCSc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C17H13F7N2S/c1-2-9-27-14-8-7-11(12-5-3-4-6-13(12)14)10-25-26-17(23,24)15(18,19)16(20,21)22/h2-8,10,26H,1,9H2/b25-10+ |
| InChIKey | ZUCLUHNXDRHKEJ-KIBLKLHPSA-N |
| XLogP | 5.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|