C21H24Br2N4O3 — CID 6875439
1-[(Z)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-3-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]urea (PubChem CID 6875439) has the molecular formula C21H24Br2N4O3 and a molecular weight of 540.26 g/mol. Its IUPAC name is 1-[(Z)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-3-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]urea.
| Compound Name | 1-[(Z)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-3-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 6875439 |
| Molecular Formula | C21H24Br2N4O3 |
| Molecular Weight | 540.26 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 1-[(Z)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-3-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]urea |
| SMILES | CC(C)Oc1ccc(Br)cc1/C=N\NC(=O)N/N=C/c1cc(Br)ccc1OC(C)C |
| InChI | InChI=1S/C21H24Br2N4O3/c1-13(2)29-19-7-5-17(22)9-15(19)11-24-26-21(28)27-25-12-16-10-18(23)6-8-20(16)30-14(3)4/h5-14H,1-4H3,(H2,26,27,28)/b24-11-,25-12+ |
| InChIKey | YXCCOAFLNXGUQA-PPPTVUPGSA-N |
| XLogP | 5.45 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.26 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|