C23H28BrN3O4 — CID 4309026
N-[(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide (PubChem CID 4309026) has the molecular formula C23H28BrN3O4 and a molecular weight of 490.40 g/mol. Its IUPAC name is N-[(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide.
| Compound Name | N-[(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 4309026 |
| Molecular Formula | C23H28BrN3O4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N-[(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C(=O)NN=Cc2cc(Br)ccc2OC(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H28BrN3O4/c1-14(2)21(22(28)26-18-7-9-19(30-5)10-8-18)23(29)27-25-13-16-12-17(24)6-11-20(16)31-15(3)4/h6-15,21H,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | NDFNWQXIFYLMON-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|