C18H19BrN2O4 — CID 135957632
5-bromo-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-2-propan-2-yloxybenzamide (PubChem CID 135957632) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-2-propan-2-yloxybenzamide.
| Compound Name | 5-bromo-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 135957632 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 5-bromo-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-2-propan-2-yloxybenzamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=O)c2cc(Br)ccc2OC(C)C)c1 |
| InChI | InChI=1S/C18H19BrN2O4/c1-11(2)25-17-7-4-13(19)9-15(17)18(23)21-20-10-12-8-14(24-3)5-6-16(12)22/h4-11,22H,1-3H3,(H,21,23)/b20-10+ |
| InChIKey | AEZCPWWWDSXAMO-KEBDBYFISA-N |
| XLogP | 3.71 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|