C19H23BrN2O3 — CID 133169137
N-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 133169137) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 133169137 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[(E)-(5-bromo-2-propan-2-yloxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C/c2cc(Br)ccc2OC(C)C)cc1OC |
| InChI | InChI=1S/C19H23BrN2O3/c1-13(2)25-17-8-6-16(20)10-15(17)12-22-21-11-14-5-7-18(23-3)19(9-14)24-4/h5-10,12-13,21H,11H2,1-4H3/b22-12+ |
| InChIKey | VYBSMGMIDAYCCT-WSDLNYQXSA-N |
| XLogP | 4.38 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|