C14H15BrN2O2S — CID 92658394
N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 92658394) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 92658394 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C\c2ccc(Br)s2)cc1OC |
| InChI | InChI=1S/C14H15BrN2O2S/c1-18-12-5-3-10(7-13(12)19-2)8-16-17-9-11-4-6-14(15)20-11/h3-7,9,16H,8H2,1-2H3/b17-9- |
| InChIKey | PEBMYKDUZMNQDV-MFOYZWKCSA-N |
| XLogP | 3.65 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|