C18H20I2N2O3 — CID 133169319
1-(3,4-dimethoxyphenyl)-N-[(E)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]methanamine (PubChem CID 133169319) has the molecular formula C18H20I2N2O3 and a molecular weight of 566.18 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[(E)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]methanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[(E)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 133169319 |
| Molecular Formula | C18H20I2N2O3 |
| Molecular Weight | 566.18 g/mol |
| Exact Mass | 565.96 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[(E)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]methanamine |
| SMILES | CCOc1c(I)cc(/C=N/NCc2ccc(OC)c(OC)c2)cc1I |
| InChI | InChI=1S/C18H20I2N2O3/c1-4-25-18-14(19)7-13(8-15(18)20)11-22-21-10-12-5-6-16(23-2)17(9-12)24-3/h5-9,11,21H,4,10H2,1-3H3/b22-11+ |
| InChIKey | RMALHEZMYIICIV-SSDVNMTOSA-N |
| XLogP | 4.44 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|