C16H12BrClN2O3S — CID 2293690
N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4-chlorobenzenesulfonamide (PubChem CID 2293690) has the molecular formula C16H12BrClN2O3S and a molecular weight of 427.71 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4-chlorobenzenesulfonamide.
| Compound Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 2293690 |
| Molecular Formula | C16H12BrClN2O3S |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4-chlorobenzenesulfonamide |
| SMILES | C#CCOc1ccc(Br)cc1C=NNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12BrClN2O3S/c1-2-9-23-16-8-3-13(17)10-12(16)11-19-20-24(21,22)15-6-4-14(18)5-7-15/h1,3-8,10-11,20H,9H2 |
| InChIKey | PZTHVAGEUSMNJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|