C18H12BrCl2N3O3 — CID 45054936
N'-[(E)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide (PubChem CID 45054936) has the molecular formula C18H12BrCl2N3O3 and a molecular weight of 469.12 g/mol. Its IUPAC name is N'-[(E)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide.
| Compound Name | N'-[(E)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 45054936 |
| Molecular Formula | C18H12BrCl2N3O3 |
| Molecular Weight | 469.12 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | N'-[(E)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide |
| SMILES | C#CCOc1ccc(Br)cc1/C=N/NC(=O)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H12BrCl2N3O3/c1-2-7-27-16-6-3-12(19)8-11(16)10-22-24-18(26)17(25)23-15-9-13(20)4-5-14(15)21/h1,3-6,8-10H,7H2,(H,23,25)(H,24,26)/b22-10+ |
| InChIKey | NGQITWJGTNWCPF-LSHDLFTRSA-N |
| XLogP | 3.86 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.12 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|