C19H17BrN2O4 — CID 6300994
N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 6300994) has the molecular formula C19H17BrN2O4 and a molecular weight of 417.26 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 6300994 |
| Molecular Formula | C19H17BrN2O4 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | C#CCOc1ccc(Br)cc1/C=N\NC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C19H17BrN2O4/c1-4-7-26-18-6-5-15(20)8-14(18)12-21-22-19(23)13-9-16(24-2)11-17(10-13)25-3/h1,5-6,8-12H,7H2,2-3H3,(H,22,23)/b21-12- |
| InChIKey | BLVQPIFKLLQTKQ-MTJSOVHGSA-N |
| XLogP | 3.24 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|