C24H19BrN2O4 — CID 4522327
N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide (PubChem CID 4522327) has the molecular formula C24H19BrN2O4 and a molecular weight of 479.33 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide.
| Compound Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide |
|---|---|
| PubChem CID | 4522327 |
| Molecular Formula | C24H19BrN2O4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide |
| SMILES | C#CCOc1ccc(Br)cc1C=NNC(=O)C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C24H19BrN2O4/c1-2-15-29-22-14-13-19(25)16-18(22)17-26-27-23(28)24(30-20-9-5-3-6-10-20)31-21-11-7-4-8-12-21/h1,3-14,16-17,24H,15H2,(H,27,28) |
| InChIKey | KDVAVDCPZDZBFM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|