C22H21BrFN3O3 — CID 5039361
N-[1-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 5039361) has the molecular formula C22H21BrFN3O3 and a molecular weight of 474.33 g/mol. Its IUPAC name is N-[1-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5039361 |
| Molecular Formula | C22H21BrFN3O3 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[1-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | C#CCOc1ccc(Br)cc1C=NNC(=O)C(NC(=O)c1ccccc1F)C(C)C |
| InChI | InChI=1S/C22H21BrFN3O3/c1-4-11-30-19-10-9-16(23)12-15(19)13-25-27-22(29)20(14(2)3)26-21(28)17-7-5-6-8-18(17)24/h1,5-10,12-14,20H,11H2,2-3H3,(H,26,28)(H,27,29) |
| InChIKey | CESKLVVECYYXSU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|