C21H22BrClN4O4 — CID 3571407
N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide (PubChem CID 3571407) has the molecular formula C21H22BrClN4O4 and a molecular weight of 509.79 g/mol. Its IUPAC name is N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide.
| Compound Name | N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 3571407 |
| Molecular Formula | C21H22BrClN4O4 |
| Molecular Weight | 509.79 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)NN=Cc1cc(Br)ccc1OCC(N)=O |
| InChI | InChI=1S/C21H22BrClN4O4/c1-12(2)19(26-20(29)15-5-3-4-6-16(15)23)21(30)27-25-10-13-9-14(22)7-8-17(13)31-11-18(24)28/h3-10,12,19H,11H2,1-2H3,(H2,24,28)(H,26,29)(H,27,30) |
| InChIKey | BRXULPHGQQYSDQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|