C27H25FN4O3 — CID 3945288
N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 3945288) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3945288 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NN=Cc1ccccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H25FN4O3/c1-18(2)25(31-26(33)22-12-6-7-13-23(22)28)27(34)32-30-16-20-10-5-8-14-24(20)35-17-21-11-4-3-9-19(21)15-29/h3-14,16,18,25H,17H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | QHSDWGLGANPODE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|