C13H9BrCl2N2O4S — CID 136789494
4-bromo-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 136789494) has the molecular formula C13H9BrCl2N2O4S and a molecular weight of 440.10 g/mol. Its IUPAC name is 4-bromo-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 136789494 |
| Molecular Formula | C13H9BrCl2N2O4S |
| Molecular Weight | 440.10 g/mol |
| Exact Mass | 437.88 |
| IUPAC Name | 4-bromo-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | O=S(=O)(N/N=C/c1cc(Cl)c(O)c(Cl)c1O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H9BrCl2N2O4S/c14-8-1-3-9(4-2-8)23(21,22)18-17-6-7-5-10(15)13(20)11(16)12(7)19/h1-6,18-20H/b17-6+ |
| InChIKey | WNNFUHOZKLKFDW-UBKPWBPPSA-N |
| XLogP | 3.48 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|