C13H9BrCl2N2O2S — CID 5434258
4-bromo-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzenesulfonamide (PubChem CID 5434258) has the molecular formula C13H9BrCl2N2O2S and a molecular weight of 408.10 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5434258 |
| Molecular Formula | C13H9BrCl2N2O2S |
| Molecular Weight | 408.10 g/mol |
| Exact Mass | 405.89 |
| IUPAC Name | 4-bromo-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzenesulfonamide |
| SMILES | O=S(=O)(N/N=C\c1ccc(Cl)c(Cl)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H9BrCl2N2O2S/c14-10-2-4-11(5-3-10)21(19,20)18-17-8-9-1-6-12(15)13(16)7-9/h1-8,18H/b17-8- |
| InChIKey | KDGJYZVEUXIQAK-IUXPMGMMSA-N |
| XLogP | 4.07 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.10 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|