C17H18Cl2N2O3S — CID 110516135
3,4-dichloro-N-[(E)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]benzenesulfonamide (PubChem CID 110516135) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[(E)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110516135 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3,4-dichloro-N-[(E)-[4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]benzenesulfonamide |
| SMILES | CC(C)(C)Oc1ccc(/C=N/NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-17(2,3)24-13-6-4-12(5-7-13)11-20-21-25(22,23)14-8-9-15(18)16(19)10-14/h4-11,21H,1-3H3/b20-11+ |
| InChIKey | JXPJEAVNRLNJMV-RGVLZGJSSA-N |
| XLogP | 4.48 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|