C12H10Cl2N2O3S — CID 110516073
3,4-dichloro-N-[(E)-(5-methylfuran-2-yl)methylideneamino]benzenesulfonamide (PubChem CID 110516073) has the molecular formula C12H10Cl2N2O3S and a molecular weight of 333.20 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-(5-methylfuran-2-yl)methylideneamino]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[(E)-(5-methylfuran-2-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110516073 |
| Molecular Formula | C12H10Cl2N2O3S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 3,4-dichloro-N-[(E)-(5-methylfuran-2-yl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(/C=N/NS(=O)(=O)c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C12H10Cl2N2O3S/c1-8-2-3-9(19-8)7-15-16-20(17,18)10-4-5-11(13)12(14)6-10/h2-7,16H,1H3/b15-7+ |
| InChIKey | LCARHRYWIPYUBB-VIZOYTHASA-N |
| XLogP | 3.21 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|