C11H8BrCl2N5O2S — CID 88724312
N-[(Z)-(3-amino-5,6-dichloropyrazin-2-yl)methylideneamino]-4-bromobenzenesulfonamide (PubChem CID 88724312) has the molecular formula C11H8BrCl2N5O2S and a molecular weight of 425.10 g/mol. Its IUPAC name is N-[(Z)-(3-amino-5,6-dichloropyrazin-2-yl)methylideneamino]-4-bromobenzenesulfonamide.
| Compound Name | N-[(Z)-(3-amino-5,6-dichloropyrazin-2-yl)methylideneamino]-4-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 88724312 |
| Molecular Formula | C11H8BrCl2N5O2S |
| Molecular Weight | 425.10 g/mol |
| Exact Mass | 422.90 |
| IUPAC Name | N-[(Z)-(3-amino-5,6-dichloropyrazin-2-yl)methylideneamino]-4-bromobenzenesulfonamide |
| SMILES | Nc1nc(Cl)c(Cl)nc1/C=N\NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H8BrCl2N5O2S/c12-6-1-3-7(4-2-6)22(20,21)19-16-5-8-11(15)18-10(14)9(13)17-8/h1-5,19H,(H2,15,18)/b16-5- |
| InChIKey | JVISDLZECPKIMJ-BNCCVWRVSA-N |
| XLogP | 2.44 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.10 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|