C19H16F8N2O2 — CID 126045310
N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126045310) has the molecular formula C19H16F8N2O2 and a molecular weight of 456.33 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126045310 |
| Molecular Formula | C19H16F8N2O2 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CCOc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C19H16F8N2O2/c1-2-30-16-9-12(10-28-29-19(26,27)17(21,22)18(23,24)25)6-7-15(16)31-11-13-4-3-5-14(20)8-13/h3-10,29H,2,11H2,1H3/b28-10+ |
| InChIKey | PTKFAIRQKRUNLK-ORBVJSQLSA-N |
| XLogP | 5.52 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|