C19H16F7N3O4 — CID 126039737
N-[(E)-[3-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126039737) has the molecular formula C19H16F7N3O4 and a molecular weight of 483.34 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[3-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126039737 |
| Molecular Formula | C19H16F7N3O4 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CCOc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)ccc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16F7N3O4/c1-2-32-16-9-12(10-27-28-19(25,26)17(20,21)18(22,23)24)6-7-15(16)33-11-13-4-3-5-14(8-13)29(30)31/h3-10,28H,2,11H2,1H3/b27-10+ |
| InChIKey | KYOQTODFIVJBGF-YPXUMCKCSA-N |
| XLogP | 5.29 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|