C17H10BrF8N3O3 — CID 126038419
N-[(Z)-[3-bromo-4-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126038419) has the molecular formula C17H10BrF8N3O3 and a molecular weight of 536.17 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126038419 |
| Molecular Formula | C17H10BrF8N3O3 |
| Molecular Weight | 536.17 g/mol |
| Exact Mass | 534.98 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | O=[N+]([O-])c1cc(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H10BrF8N3O3/c18-12-5-10(7-27-28-17(25,26)15(20,21)16(22,23)24)6-13(29(30)31)14(12)32-8-9-1-3-11(19)4-2-9/h1-7,28H,8H2/b27-7- |
| InChIKey | HTYSVLIUCQGJNH-FEDGQQDLSA-N |
| XLogP | 5.79 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.17 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|