C16H10F5N3O2 — CID 6884306
N-[2-oxo-2-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 6884306) has the molecular formula C16H10F5N3O2 and a molecular weight of 371.27 g/mol. Its IUPAC name is N-[2-oxo-2-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 6884306 |
| Molecular Formula | C16H10F5N3O2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[2-oxo-2-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)N/N=C/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H10F5N3O2/c17-11-9(12(18)14(20)15(21)13(11)19)6-23-24-10(25)7-22-16(26)8-4-2-1-3-5-8/h1-6H,7H2,(H,22,26)(H,24,25)/b23-6+ |
| InChIKey | DSRSKKHFSAEQJG-TXNBCWFRSA-N |
| XLogP | 2.26 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|