C17H12F5N3O2 — CID 3816825
N-[1-oxo-1-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]propan-2-yl]benzamide (PubChem CID 3816825) has the molecular formula C17H12F5N3O2 and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[1-oxo-1-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]propan-2-yl]benzamide.
| Compound Name | N-[1-oxo-1-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 3816825 |
| Molecular Formula | C17H12F5N3O2 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[1-oxo-1-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)NN=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H12F5N3O2/c1-8(24-17(27)9-5-3-2-4-6-9)16(26)25-23-7-10-11(18)13(20)15(22)14(21)12(10)19/h2-8H,1H3,(H,24,27)(H,25,26) |
| InChIKey | FUHGWXGZBXAUJB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|