C14H7F5N2O2 — CID 4683367
2-hydroxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide (PubChem CID 4683367) has the molecular formula C14H7F5N2O2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-hydroxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4683367 |
| Molecular Formula | C14H7F5N2O2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-hydroxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1c(F)c(F)c(F)c(F)c1F)c1ccccc1O |
| InChI | InChI=1S/C14H7F5N2O2/c15-9-7(10(16)12(18)13(19)11(9)17)5-20-21-14(23)6-3-1-2-4-8(6)22/h1-5,22H,(H,21,23) |
| InChIKey | QJCQJZYKGTZRPC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|