C9H7Cl3N2O2 — CID 70615404
2-hydroxy-N-(2,2,2-trichloroethylideneamino)benzamide (PubChem CID 70615404) has the molecular formula C9H7Cl3N2O2 and a molecular weight of 281.53 g/mol. Its IUPAC name is 2-hydroxy-N-(2,2,2-trichloroethylideneamino)benzamide.
| Compound Name | 2-hydroxy-N-(2,2,2-trichloroethylideneamino)benzamide |
|---|---|
| PubChem CID | 70615404 |
| Molecular Formula | C9H7Cl3N2O2 |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 2-hydroxy-N-(2,2,2-trichloroethylideneamino)benzamide |
| SMILES | O=C(NN=CC(Cl)(Cl)Cl)c1ccccc1O |
| InChI | InChI=1S/C9H7Cl3N2O2/c10-9(11,12)5-13-14-8(16)6-3-1-2-4-7(6)15/h1-5,15H,(H,14,16) |
| InChIKey | QHMSTMXARBTADA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|