C12H16N2O2 — CID 3686688
2-hydroxy-N-(pentylideneamino)benzamide (PubChem CID 3686688) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-hydroxy-N-(pentylideneamino)benzamide.
| Compound Name | 2-hydroxy-N-(pentylideneamino)benzamide |
|---|---|
| PubChem CID | 3686688 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-hydroxy-N-(pentylideneamino)benzamide |
| SMILES | CCCCC=NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C12H16N2O2/c1-2-3-6-9-13-14-12(16)10-7-4-5-8-11(10)15/h4-5,7-9,15H,2-3,6H2,1H3,(H,14,16) |
| InChIKey | OTDJKRWJCIRSDU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|