C16H13F3N2O4 — CID 57397723
N-[(E)-benzylideneamino]-2-hydroxybenzamide;2,2,2-trifluoroacetic acid (PubChem CID 57397723) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-hydroxybenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(E)-benzylideneamino]-2-hydroxybenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 57397723 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-hydroxybenzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N/N=C/c1ccccc1)c1ccccc1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H12N2O2.C2HF3O2/c17-13-9-5-4-8-12(13)14(18)16-15-10-11-6-2-1-3-7-11;3-2(4,5)1(6)7/h1-10,17H,(H,16,18);(H,6,7)/b15-10+; |
| InChIKey | OZSCGPAFQWEHFT-GYVLLFFHSA-N |
| XLogP | 2.79 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|