C14H8F5N3O — CID 3395739
2-amino-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide (PubChem CID 3395739) has the molecular formula C14H8F5N3O and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-amino-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3395739 |
| Molecular Formula | C14H8F5N3O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-amino-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
| SMILES | Nc1ccccc1C(=O)NN=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H8F5N3O/c15-9-7(10(16)12(18)13(19)11(9)17)5-21-22-14(23)6-3-1-2-4-8(6)20/h1-5H,20H2,(H,22,23) |
| InChIKey | DSOSJTPGIKBGCR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|