C16H12BrCl2N3O2 — CID 6249030
3-bromo-N-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 6249030) has the molecular formula C16H12BrCl2N3O2 and a molecular weight of 429.10 g/mol. Its IUPAC name is 3-bromo-N-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 6249030 |
| Molecular Formula | C16H12BrCl2N3O2 |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | 3-bromo-N-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)N/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H12BrCl2N3O2/c17-11-4-1-3-10(7-11)16(24)20-9-15(23)22-21-8-12-13(18)5-2-6-14(12)19/h1-8H,9H2,(H,20,24)(H,22,23)/b21-8- |
| InChIKey | YBMBJBHDQQRVTP-WNFQYIGGSA-N |
| XLogP | 3.64 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|