C20H14F4N2O — CID 4643919
2,3,5,6-tetrafluoro-N-[(3-phenylmethoxyphenyl)methylideneamino]aniline (PubChem CID 4643919) has the molecular formula C20H14F4N2O and a molecular weight of 374.34 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(3-phenylmethoxyphenyl)methylideneamino]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(3-phenylmethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 4643919 |
| Molecular Formula | C20H14F4N2O |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(3-phenylmethoxyphenyl)methylideneamino]aniline |
| SMILES | Fc1cc(F)c(F)c(NN=Cc2cccc(OCc3ccccc3)c2)c1F |
| InChI | InChI=1S/C20H14F4N2O/c21-16-10-17(22)19(24)20(18(16)23)26-25-11-14-7-4-8-15(9-14)27-12-13-5-2-1-3-6-13/h1-11,26H,12H2 |
| InChIKey | RONLGFQJGMCNQZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|