C43H36N8O2 — CID 6313295
2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 6313295) has the molecular formula C43H36N8O2 and a molecular weight of 696.82 g/mol. Its IUPAC name is 2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 6313295 |
| Molecular Formula | C43H36N8O2 |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.30 |
| IUPAC Name | 2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | C(=N\Nc1nc(N/N=C\c2cccc(OCc3ccccc3)c2)nc(N(c2ccccc2)c2ccccc2)n1)\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C43H36N8O2/c1-5-15-33(16-6-1)31-52-39-25-13-19-35(27-39)29-44-49-41-46-42(48-43(47-41)51(37-21-9-3-10-22-37)38-23-11-4-12-24-38)50-45-30-36-20-14-26-40(28-36)53-32-34-17-7-2-8-18-34/h1-30H,31-32H2,(H2,46,47,48,49,50)/b44-29-,45-30- |
| InChIKey | HYRNWYYSOKLOSB-QSFOISPVSA-N |
| XLogP | 9.39 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|