C22H17BrCl2F3N3O2 — CID 126107706
N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126107706) has the molecular formula C22H17BrCl2F3N3O2 and a molecular weight of 563.20 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126107706 |
| Molecular Formula | C22H17BrCl2F3N3O2 |
| Molecular Weight | 563.20 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17BrCl2F3N3O2/c1-2-32-19-8-13(10-30-31-20-6-4-15(11-29-20)22(26,27)28)7-17(23)21(19)33-12-14-3-5-16(24)9-18(14)25/h3-11H,2,12H2,1H3,(H,29,31)/b30-10- |
| InChIKey | XXJSMGPUFCTFSF-TWUOJQIPSA-N |
| XLogP | 7.59 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.20 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|